Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1252 |
| Product Name | Tetrahydromagnolol |
| CAS | 20601-85-8 |
| Structure |  |
| Synonyms | Magnolignan |
| IUPAC Name | 2-(2-hydroxy-5-propylphenyl)-4-propylphenol |
| Molecular Weight | 270.4 g/mol |
| Molecular Formula | C18H22O2 |
| InChI | InChI=1S/C18H22O2/c1-3-5-13-7-9-17(19)15(11-13)16-12-14(6-4-2)8-10-18(16)20/h7-12,19-20H,3-6H2,1-2H3 |
| InChI Key | OYAQUBKYAKSHOA-UHFFFAOYSA-N |
| Boiling Point | 165.5-166 °C |
| Melting Point | 144.5 °C |
| Purity | 95% |
| Density | 1.08 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CCCC1=CC(=C(C=C1)O)C2=C(C=CC(=C2)CCC)O |
| pKa | 9.26±0.43 |
If you have any questions, please contact us. You will get a satisfactory answer.
