Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0070 |
| Product Name | Tetrahydrocurcumin |
| CAS | 36062-04-1 |
| Structure |  |
| Synonyms | THC |
| IUPAC Name | 1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-dione |
| Molecular Weight | 372.4 g/mol |
| Molecular Formula | C21H24O6 |
| InChI | InChI=1S/C21H24O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h5-6,9-12,24-25H,3-4,7-8,13H2,1-2H3 |
| InChI Key | LBTVHXHERHESKG-UHFFFAOYSA-N |
| Boiling Point | 564.1±45.0 °C |
| Melting Point | 95-97ºC |
| Flash Point | 564.1±45.0 °C |
| Purity | 95% |
| Density | 1.22 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.01 |
| Isomeric SMILES | COC1=C(C=CC(=C1)CCC(=O)CC(=O)CCC2=CC(=C(C=C2)O)OC)O |
| pKa | 9.12±0.10 |
What is the synonym for Tetrahydrocurcumin?
SabiWhite
What is the molecular formula of Tetrahydrocurcumin?
C21H24O6
What is the boiling point of Tetrahydrocurcumin?
564.1±45.0 °C
What color is Tetrahydrocurcumin in its pure form?
Light yellow to yellow
Where is Tetrahydrocurcumin naturally sourced from?
Roots of Curcuma zedoaria, Zingiber mioga, and Zingiber officinale
What are the main uses of Tetrahydrocurcumin?
Antioxidant and skin-whitening ingredient
How is Tetrahydrocurcumin chemically synthesized from curcumin?
By catalytic hydrogenation using PtO2 or palladium as a catalyst
What is the main biological activity of Tetrahydrocurcumin?
Antioxidant, anti-inflammatory, anti-angiogenic, and anticancer properties
How does Tetrahydrocurcumin inhibit melanin production?
By inhibiting tyrosinase
What are the potential benefits of Tetrahydrocurcumin in skincare?
Whitening effect, antioxidant properties, anti-aging benefits.
If you have any questions, please contact us. You will get a satisfactory answer.
