Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0051 |
| Product Name | Tetrabutyl Ethylidenebisphenol |
| CAS | 35958-30-6 |
| Structure |  |
| Synonyms | 2,2'-Ethylidenebis (4,5-di-tert.-butylphenol) |
| IUPAC Name | 2,4-ditert-butyl-6-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenol |
| Molecular Weight | 438.69 g/mol |
| Molecular Formula | C57H98O6 |
| InChI | InChI=1S/C30H46O2/c1-18(21-14-19(27(2,3)4)16-23(25(21)31)29(8,9)10)22-15-20(28(5,6)7)17-24(26(22)32)30(11,12)13/h14-18,31-32H,1-13H3 |
| InChI Key | DXCHWXWXYPEZKM-UHFFFAOYSA-N |
| Boiling Point | 464.8±40.0 °C |
| Melting Point | 162-164 °C |
| Purity | 95% |
| Density | 0.975 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.001 |
| Isomeric SMILES | CC(C1=C(C(=CC(=C1)C(C)(C)C)C(C)(C)C)O)C2=C(C(=CC(=C2)C(C)(C)C)C(C)(C)C)O |
| pKa | 11.28±0.5 |
If you have any questions, please contact us. You will get a satisfactory answer.
