Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-EO-0022 |
| Product Name | Tea tree oil |
| CAS | 68647-73-4 |
| IUPAC Name | zinc;diheptoxy-sulfanylidene-sulfido-lambda5-phosphane |
| Molecular Weight | 716.4 g/mol |
| Molecular Formula | C28H60O4P2S4Zn |
| InChI | InChI=1S/2C14H31O2PS2.Zn/c2*1-3-5-7-9-11-13-15-17(18,19)16-14-12-10-8-6-4-2;/h2*3-14H2,1-2H3,(H,18,19);/q;;+2/p-2 |
| InChI Key | ZKAQFYDDTYGBBV-UHFFFAOYSA-L |
| Purity | Terpine-4-ol content: ≥35% |
| Appearance | Liquid |
| EC Number | 285-377-1Mixture |
| Isomeric SMILES | CCCCCCCOP(=S)(OCCCCCCC)[S-].CCCCCCCOP(=S)(OCCCCCCC)[S-].[Zn+2] |
| MDL Number | MFCD00132409 |
| Storage Conditions | Room temperature |
What are some synonyms for tea tree oil?
Organic Tea Tree Oil; Sesame Oil (Sesamum Indicum); MELALEUCA ALTERNIFOLIA (TEA TREE) LEAF OIL; Melasol; melaleuca alternifolia oil; MELALEUCA OIL; 1 3 4 6 7 8-HEXAHYDRO-4 6 6 7 8 8-HEXA&; OilofMalaleuca
What is the CAS number for tea tree oil?
68647-73-4
Can you provide a brief description of tea tree oil's chemical properties?
Tea tree oil has a boiling point of 165°C, density of 0.878 g/mL at 25°C, refractive index of 1.478, and an odor described as citrus spicy terpenic nutmeg pine.
What are some safety hazard codes associated with tea tree oil?
Xn, Xi
How is tea tree oil typically obtained?
By steam distillation of leaves and twig tips of Melaleuca alternifolia and other Melaleuca species.
What are some of the main components of tea tree oil besides 1-terpinen-4-ol?
γ-terpinene and α-terpinene
What are some common uses of tea tree oil?
Antiseptic, remedy for skin and nail conditions, in household products, and perfumery uses among others.
What are the benefits of tea tree oil for skin disorders?
It promotes healing, acts against bacteria, yeast, and fungi, and helps with conditions like seborrhea, psoriasis, eczema, and dermatitis.
How is tea tree oil used in aromatherapy?
It is ideal for aromatherapy due to its low toxicity and ability to dissolve pus without damaging the skin's surface. It is particularly beneficial for acne, problem, and congested skin types.
If you have any questions, please contact us. You will get a satisfactory answer.
