Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0087 |
| Product Name | Styrene/MA Copolymer |
| CAS | 9011-13-6 |
| Structure |  |
| Synonyms | 2,5-Furandione,polymerwithethenylbenzene |
| IUPAC Name | furan-2,5-dione;styrene |
| Molecular Weight | 606.62 g/mol |
| Molecular Formula | C36H30O9X2 |
| InChI | InChI=1S/C8H8.C4H2O3/c1-2-8-6-4-3-5-7-8;5-3-1-2-4(6)7-3/h2-7H,1H2;1-2H |
| InChI Key | WOLATMHLPFJRGC-UHFFFAOYSA-N |
| Melting Point | 160 °C |
| Purity | 0.98 |
| Density | 1.27 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C=CC1=CC=CC=C1.C1=CC(=O)OC1=O |
If you have any questions, please contact us. You will get a satisfactory answer.
