Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-0212 |
| Product Name | Sorbitan Monooleate |
| CAS | 1338-43-8 |
| Structure |  |
| Synonyms | 1,4-Anhydro-6-O-[(9Z)-Octadec-9-Enoyl]-D-Glucitol |
| Description | Sorbitan Monooleate is a synthetic compound that is derived from sorbitol, a sugar alcohol. Sorbitan Monooleate acts as a surfactant, which means it helps to stabilize mixtures of water and oil. Sorbitan Monooleate is also used in the cosmetic industry as an emulsifier and thickener in various creams, lotions, and other personal care products. |
| IUPAC Name | [(2R)-2-[(2R,3R,4S)-3,4-Dihydroxyoxolan-2-yl]-2-hydroxyethyl] (Z)-octadec-9-enoate |
| Molecular Weight | 428.60 g/mol |
| Molecular Formula | C24H44O6 |
| Canonical SMILES | CCCCCCCC/C=C\\CCCCCCCC(=O)OC[C@H]([C@@H]1[C@@H]([C@H](CO1)O)O)O |
| InChI | InChI=1S/C24H44O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)29-19-21(26)24-23(28)20(25)18-30-24/h9-10,20-21,23-26,28H,2-8,11-19H2,1H3/b10-9-/t20-,21+,23+,24+/m0/s1 |
| InChI Key | NWGKJDSIEKMTRX-AAZCQSIUSA-N |
| Boiling Point | >260 °C |
| Purity | 99%+ |
| Appearance | yellowish-brown oily liquid or a waxy solid at room temperature |
| Application | 1. Emulsifier: Sorbitan Monooleate is commonly used as an emulsifier in food and skincare products. 2. Surfactant: It acts as a surfactant, which means it lowers the surface tension between two substances, allowing them to mix together. 3. Stabilizer: This ingredient helps to stabilize emulsions and prevent separation of oil and water-based ingredients. 4. Thickener: Sorbitan Monooleate is used as a thickener in some personal care products such as shampoos and conditioners. 5. Solubilizer: It can help to dissolve oils and other hydrophobic ingredients in water-based formulations, making it easier to create homogeneous products. 6. Anti-foaming agent: It is also used as an anti-foaming agent to prevent excessive foaming in food and cosmetic products. 7. Mold release agent: In the plastic and rubber industry, Sorbitan Monooleate is used as a mold release agent, preventing substances from sticking to molds. |
| Features And Benefits | 1. Acts as an emulsifier 2. Enhances stability of formulations 3. Improves texture and spreadability of products 4. Increases solubility of oils in water-based formulations 5. Helps prevent moisture loss from skin 6. Can act as a thickener in certain formulations. |
| Isomeric SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H]([C@@H]1[C@@H]([C@H](CO1)O)O)O |
| Topological Polar Surface Area | 96.2 Ų |
What is the chemical formula of Span 80?
The chemical formula of Span 80 is C24H44O6.
In what form is Span 80 found?
Span 80 is found in the form of a brownish-yellow, viscous liquid.
How is Span 80 described in terms of odor?
Span 80 is described as having a fatty oily waxy odor.
What is the Hydrophilic-Lipophilic Balance (HLB) of Span 80?
The HLB of Span 80 is 4.3.
What are the main uses of Span 80?
Span 80 is used as an emulsifier in cosmetic formulations, oil field chemicals, plastics, household products, coatings, and textiles.
Is Span 80 soluble in water?
Span 80 is practically insoluble but dispersible in water, and is soluble in fatty oils producing a hazy solution.
What safety statements are associated with Span 80?
Safety Statements 24/25 are associated with Span 80.
What is the Hazardous Substances Data for Span 80?
The Hazardous Substances Data for Span 80 is 1338-43-8.
What are the safety precautions for handling Span 80?
Span 80 should be stored below +30°C, and is combustible and incompatible with strong oxidizing agents.
How is Span 80 described in terms of its stability?
Span 80 is described as stable, but should be handled with caution as it is combustible and incompatible with strong oxidizing agents.
If you have any questions, please contact us. You will get a satisfactory answer.
