Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-0205 |
Product Name | Sorbitan Laurate |
CAS | 1338-39-2 |
Structure | |
Synonyms | Sorbitan, esters, monododecanoate;Sorbitan, monododecanoate;Sorbitan, monolaurate;Sorbitan monolaurate;Anhydrosorbitol monolaurate;Lauric acid sorbitan ester;Span 20 |
Description | Acts as liquid, non-ionic, lipophilic w/o emulsifier. Saponification value 157-171. |
IUPAC Name | [2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] dodecanoate |
Molecular Weight | 346.46 g/mol |
Molecular Formula | C18H34O6 |
Canonical SMILES | CCCCCCCCCCCC(=O)OCC([C@@H]1[C@@H]([C@H](CO1)O)O)O |
InChI | LWZFANDGMFTDAV-WYDSMHRWSA-N |
InChI Key | InChI=1S/C18H34O6/c1-2-3-4-5-6-7-8-9-10-11-16(21)23-13-15(20)18-17(22)14(19)12-24-18/h14-15,17-20,22H,2-13H2,1H3/t14-,15?,17+,18+/m0/s1 |
Boiling Point | 400 °C |
Density | 1.032 g/mL |
Appearance | Amber liquid |
Application | Emulsions for skin and hair care products |
Storage | Store light-protected at a cool and dry place |
HS Code | 3402130000 |
INCI | Sorbitan laurate |
Uses | Recommended use level 1-5%. For external use only. |
What is the chemical formula of Span 20?
The chemical formula of Span 20 is C18H34O6.
What is the molecular weight of Span 20?
The molecular weight of Span 20 is 346.46.
What is the boiling point of Span 20?
The boiling point of Span 20 is approximately 401.18°C.
Is Span 20 soluble in water?
Span 20 is practically insoluble in water, but it is dispersible.
What is the color of Span 20?
Span 20 is a clear amber color.
What is the hydrophilic-lipophilic balance (HLB) of Span 20?
The HLB of Span 20 is 8.6.
What are some common uses of Span 20?
Span 20 is used as a lubricant, emulsifier in cosmetic creams, stabilizer of essential oils, and detergent.
How is Span 20 stored?
Span 20 should be stored below +30°C.