Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0089 |
| Product Name | Sodium 5-Nitroguaiacolate |
| CAS | 67233-85-6 |
| Structure |  |
| Synonyms | Phenol, 2-methoxy-5-nitro-, sodium salt |
| IUPAC Name | sodium;2-methoxy-5-nitrophenolate |
| Molecular Weight | 191.12 g/mol |
| Molecular Formula | C7H6NNaO4 |
| InChI | InChI=1S/C7H7NO4.Na/c1-12-7-3-2-5(8(10)11)4-6(7)9;/h2-4,9H,1H3;/q;+1/p-1 |
| InChI Key | KBRKFTKQRMYINW-UHFFFAOYSA-M |
| Melting Point | 105-106 °C |
| Purity | 95% |
| Solubility | Soluble in water |
| Appearance | Solid |
| Isomeric SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])[O-].[Na+] |
If you have any questions, please contact us. You will get a satisfactory answer.
