Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0212 |
| Product Name | Sodium Methylparaben |
| CAS | 5026-62-0 |
| Structure |  |
| Synonyms | Sodium 4-(methoxycarbonyl)phenolate |
| IUPAC Name | sodium;4-methoxycarbonylphenolate |
| Molecular Weight | 174.13 g/mol |
| Molecular Formula | C8H7NaO3 |
| InChI | InChI=1S/C8H8O3.Na/c1-11-8(10)6-2-4-7(9)5-3-6;/h2-5,9H,1H3;/q;+1/p-1 |
| InChI Key | PESXGULMKCKJCC-UHFFFAOYSA-M |
| Melting Point | >125 °C |
| Purity | 95% |
| Density | 1.42 g/mL |
| Appearance | Solid |
| Isomeric SMILES | COC(=O)C1=CC=C(C=C1)[O-].[Na+] |
| pKa | 8.4 |
If you have any questions, please contact us. You will get a satisfactory answer.
