Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1112 |
| Product Name | Sodium Heparin |
| CAS | 9041-08-1 |
| Structure |  |
| Synonyms | Heparin, sodium salt |
| IUPAC Name | sodium;2-[3,5-bis(2-hydroxyethyl)-1,3,5-triazinan-1-yl]ethanolate |
| Molecular Formula | (C12H16NS2Na3)20 |
| InChI | InChI=1S/C9H20N3O3.Na/c13-4-1-10-7-11(2-5-14)9-12(8-10)3-6-15;/h13-14H,1-9H2;/q-1;+1 |
| InChI Key | YOMTXLQWRQUKAK-UHFFFAOYSA-N |
| Melting Point | >181 °C |
| Purity | 90% |
| Solubility | Soluble in water |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.002 |
| Isomeric SMILES | C1N(CN(CN1CCO)CC[O-])CCO.[Na+] |
If you have any questions, please contact us. You will get a satisfactory answer.
