Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1119 |
| Product Name | Sodium Guanosine Cyclic Monophosphate |
| CAS | 40732-48-7 |
| Structure |  |
| Synonyms | Guanosine-3',5'-cyclicphosphoric acid monosodium salt |
| IUPAC Name | sodium;9-[(4aR,6R,7R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one |
| Molecular Weight | 367.19 g/mol |
| Molecular Formula | C10H11N5NaO7P |
| InChI | InChI=1S/C10H12N5O7P.Na/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6-3(21-9)1-20-23(18,19)22-6;/h2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17);/q;+1/p-1/t3-,5-,6-,9-;/m1./s1 |
| InChI Key | KMPIYXNEROUNOG-GWTDSMLYSA-M |
| Melting Point | >240 °C |
| Purity | 95% |
| Appearance | Solid |
| Isomeric SMILES | C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C3N=C(NC4=O)N)O)OP(=O)(O1)[O-].[Na+] |
If you have any questions, please contact us. You will get a satisfactory answer.
