Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1154 |
| Product Name | Sodium Glutamate |
| CAS | 142-47-2 |
| Structure |  |
| Synonyms | Sodium glutamate;L-Glutamic acid, sodium salt (1:1);Sodium hydrogen glutamate;Monosodium glutamate;FEMA No. 2756 |
| IUPAC Name | sodium;(2S)-2-amino-5-hydroxy-5-oxopentanoate |
| Molecular Weight | 169.11 g/mol |
| Molecular Formula | C5H8NNaO4 |
| InChI | InChI=1S/C5H9NO4.Na/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+1/p-1/t3-;/m0./s1 |
| InChI Key | LPUQAYUQRXPFSQ-DFWYDOINSA-M |
| Melting Point | 232 °C |
| Purity | 95% |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.02 |
| Highest Usage In Rinsing Products | 0.25 |
| Isomeric SMILES | C(CC(=O)O)[C@@H](C(=O)[O-])N.[Na+] |
What is the chemical formula of L-(+)Sodium glutamate?
The chemical formula of L-(+)Sodium glutamate is C5H10NNaO4.
What is the melting point of L-(+)Sodium glutamate?
The melting point of L-(+)Sodium glutamate is 232°C.
How is L-(+)Sodium glutamate commonly produced?
L-(+)Sodium glutamate is commonly produced using a fermentation process using glucose, often sugar molasses, as a starting substance.
What are some of the uses of L-(+)Sodium glutamate?
L-(+)Sodium glutamate is used as a flavor enhancer for foods, particularly in oriental cuisine, and it is also used in cosmetics for its skin-conditioning properties.
Who discovered the flavor enhancing properties of monosodium glutamate (MSG)?
The flavor enhancing properties of monosodium glutamate (MSG) were discovered by Dr. Kikunae Ikeda, a Japanese chemist at the University of Tokyo.
What is the risk statement associated with L-(+)Sodium glutamate?
The risk statement associated with L-(+)Sodium glutamate is 20/21/22.
What is the safety profile of L-(+)Sodium glutamate?
L-(+)Sodium glutamate is moderately toxic by the intravenous route, mildly toxic by ingestion and other routes, and it is an experimental teratogen.
How is L-(+)Sodium glutamate stored?
L-(+)Sodium glutamate should be stored in a tight container in a cool, dry place.
What is the regulatory status of L-(+)Sodium glutamate?
L-(+)Sodium glutamate is GRAS listed and accepted in Europe for use.
How does L-(+)Sodium glutamate enhance flavor in food products?
L-(+)Sodium glutamate enhances specific flavor characteristics in food products, such as impact, body, continuity, mildness, and complexity.
If you have any questions, please contact us. You will get a satisfactory answer.
