Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0027 |
| Product Name | Sodium gluconate |
| CAS | 527-07-1 |
| Structure |  |
| Synonyms | 2,3,4,5,6-Pentahydroxycaproic acid sodium salt, D-Gluconate sodium salt, Sodium D-gluconate |
| IUPAC Name | sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| Molecular Weight | 220.15 g/mol |
| Molecular Formula | C6H13NaO7 |
| InChI | InChI=1S/C6H12O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1 |
| InChI Key | UPMFZISCCZSDND-JJKGCWMISA-M |
| Melting Point | 170-175 °C |
| Purity | 0.98 |
| Appearance | White to light beige solid |
| Isomeric SMILES | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Na+] |
What is the chemical formula for Sodium gluconate?
The chemical formula for Sodium gluconate is C6H13NaO7.
What is the melting point of Sodium gluconate?
The melting point of Sodium gluconate is 170-175 °C.
What is the solubility of Sodium gluconate in water?
Sodium gluconate is very soluble in water.
What is the color of Sodium gluconate?
Sodium gluconate is white to light beige in color.
What is the safety information provided for Sodium gluconate?
The safety information for Sodium gluconate includes safety statements, WGK Germany classification, autoignition temperature, and toxicity LD50 in rabbits.
How is Sodium gluconate used in personal care products?
Sodium gluconate is used in soap, sunscreen, shampoo, toothpaste, hair products, makeup, and other personal care products as a natural preservative, skin-conditioning agent, and chelating agent.
What is the production method for Sodium gluconate?
Sodium gluconate is manufactured by the fermentation of carbohydrate-containing raw material glucose syrup derived from maize.
What function does Sodium gluconate serve in the pharmaceutical industry?
Sodium gluconate acts as a chelating agent in the pharmaceutical industry.
How is Sodium gluconate synthesized?
Sodium gluconate is synthesized by adding calcium gluconate into a reaction kettle, adding sulfuric acid aqueous solution, neutralizing it with Na2CO3, and obtaining Sodium gluconate through concentration, filtration, and drying.
How is Sodium gluconate regulated in Europe?
In Europe, Sodium gluconate is listed as a generally permitted food additive (E576) and may be added to all foodstuffs following the "quantum satis" principle.
If you have any questions, please contact us. You will get a satisfactory answer.
