Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0209 |
| Product Name | Sodium Ethylparaben |
| CAS | 35285-68-8 |
| Structure |  |
| Synonyms | Benzoic acid, 4-hydroxy-, ethyl ester, sodium salt |
| IUPAC Name | sodium;4-ethoxycarbonylphenolate |
| Molecular Weight | 188.16 g/mol |
| Molecular Formula | C9H9NaO3 |
| InChI | InChI=1S/C9H10O3.Na/c1-2-12-9(11)7-3-5-8(10)6-4-7;/h3-6,10H,2H2,1H3;/q;+1/p-1 |
| InChI Key | QYNMSPKSYXPZHG-UHFFFAOYSA-M |
| Melting Point | >115 °C |
| Flash Point | 121°C |
| Purity | 95% |
| Density | 1.34 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CCOC(=O)C1=CC=C(C=C1)[O-].[Na+] |
| pKa | 8.4 |
What is the molecular formula of Sodium Ethylparaben?
The molecular formula of Sodium Ethylparaben is C9H11NaO3.
What is the CAS number for Sodium Ethylparaben?
The CAS number for Sodium Ethylparaben is 35285-68-8.
What is the melting point of Sodium Ethylparaben?
The melting point of Sodium Ethylparaben is greater than 115°C for the free ester.
What is the density of Sodium Ethylparaben at 20°C?
The density of Sodium Ethylparaben at 20°C is 1.34.
What is the pH of a 1g/L solution of Sodium Ethylparaben in water at 20°C?
The pH of a 1g/L solution of Sodium Ethylparaben in water at 20°C is 10.
What is the water solubility of Sodium Ethylparaben at 23°C?
The water solubility of Sodium Ethylparaben at 23°C is 1000g/L.
What is the boiling point of Sodium Ethylparaben?
The boiling point of Sodium Ethylparaben is 297°C for the free ester, with decomposition.
How is Sodium Ethylparaben commonly used?
Sodium Ethylparaben is commonly used as a preservative in pharmaceutical formulations and cosmetics due to its antimicrobial characteristics.
What is the flammability and explosibility of Sodium Ethylparaben?
Sodium Ethylparaben is non-flammable.
What potential health risk is associated with Sodium Ethylparaben?
Sodium Ethylparaben, like other parabens, can induce allergic contact dermatitis, especially in cases of chronic dermatitis or wounded skin.
If you have any questions, please contact us. You will get a satisfactory answer.
