Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0007 |
| Product Name | Snake-tripeptide |
| CAS | 823202-99-9 |
| Structure |  |
| Synonyms | SYN-AKE |
| IUPAC Name | acetic acid;(2S)-N-[(2S)-4-amino-1-(benzylamino)-1-oxobutan-2-yl]-1-(3-aminopropanoyl)pyrrolidine-2-carboxamide |
| Molecular Weight | 495.6 g/mol |
| Molecular Formula | C23H37N5O7 |
| InChI | InChI=1S/C19H29N5O3.2C2H4O2/c20-10-8-15(18(26)22-13-14-5-2-1-3-6-14)23-19(27)16-7-4-12-24(16)17(25)9-11-21;2*1-2(3)4/h1-3,5-6,15-16H,4,7-13,20-21H2,(H,22,26)(H,23,27);2*1H3,(H,3,4)/t15-,16-;;/m0../s1 |
| InChI Key | HSUGRPOJOBRRBK-SXBSVMRRSA-N |
| Purity | 0.95 |
| Appearance | Solid |
| Isomeric SMILES | CC(=O)O.CC(=O)O.C1C[C@H](N(C1)C(=O)CCN)C(=O)N[C@@H](CCN)C(=O)NCC2=CC=CC=C2 |
If you have any questions, please contact us. You will get a satisfactory answer.
