Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0063 |
| Product Name | Rhamnose |
| CAS | 3615-41-6 |
| Structure |  |
| Synonyms | 6-Deoxyhexopyranose |
| IUPAC Name | (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal |
| Molecular Weight | 164.16 g/mol |
| Molecular Formula | C6H12O5 |
| InChI | InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4-,5-,6-/m0/s1 |
| InChI Key | PNNNRSAQSRJVSB-BXKVDMCESA-N |
| Boiling Point | 251.61 °C |
| Melting Point | 91-95 °C |
| Density | 1.31 g/mL |
| Appearance | White liquid |
| Isomeric SMILES | C[C@@H]([C@@H]([C@H]([C@H](C=O)O)O)O)O |
| pKa | 12.50±0.20 |
If you have any questions, please contact us. You will get a satisfactory answer.
