Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1218 |
| Product Name | Retinyl Propionate |
| CAS | 7069-42-3 |
| Structure |  |
| Synonyms | Retinol, propanoate, all-trans-;Vitamin A propionate |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] propanoate |
| Molecular Weight | 342.5 g/mol |
| Molecular Formula | C23H34O2 |
| InChI | InChI=1S/C23H34O2/c1-7-22(24)25-17-15-19(3)11-8-10-18(2)13-14-21-20(4)12-9-16-23(21,5)6/h8,10-11,13-15H,7,9,12,16-17H2,1-6H3/b11-8+,14-13+,18-10+,19-15+ |
| InChI Key | SFRPDSKECHTFQA-ONOWFSFQSA-N |
| Boiling Point | 453.7±14.0 °C |
| Flash Point | 128 °C |
| Purity | 95% |
| Density | 0.96 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.02 |
| Isomeric SMILES | CCC(=O)OC/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(CCCC1(C)C)C |
What is the chemical formula for retinyl propionate?
The chemical formula for retinyl propionate is C23H34O2.
What are some synonyms for retinyl propionate?
Some synonyms for retinyl propionate include VITAMIN A PROPIONATE and ALL TRANS-RETINOL PROPIONATE.
What is the boiling point of retinyl propionate?
The predicted boiling point of retinyl propionate is 453.7±14.0 °C.
How should retinyl propionate be stored?
Retinyl propionate should be stored at temperatures ranging from 2-8°C.
What are some safety hazard codes associated with retinyl propionate?
The hazard codes associated with retinyl propionate are Xn and T.
What is a suggested usage level for retinyl propionate in skin care?
Usage levels of retinyl propionate in skin care range from 0.1-0.4%.
What other vitamin is often paired with retinyl propionate in skin care formulations?
Niacinamide is often paired with retinyl propionate in skin care formulations.
What are some potential side effects of using retinyl propionate?
Potential side effects of using retinyl propionate include redness, irritation, dry skin, and increased sensitivity to the sun.
How does retinyl propionate affect skin aging?
Retinyl propionate effectively intervenes in the skin aging process by increasing calcium pantothenate transport rates in human serum.
What is the molecular size of retinyl propionate compared to retinoic acid?
Retinyl propionate is closest in molecular size to pure retinoic acid with just three additional carbons.
If you have any questions, please contact us. You will get a satisfactory answer.
