Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1218 |
| Product Name | Retinyl Propionate |
| CAS | 7069-42-3 |
| Structure |  |
| Synonyms | Retinol, propanoate, all-trans-;Vitamin A propionate |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] propanoate |
| Molecular Weight | 342.5 g/mol |
| Molecular Formula | C23H34O2 |
| InChI | InChI=1S/C23H34O2/c1-7-22(24)25-17-15-19(3)11-8-10-18(2)13-14-21-20(4)12-9-16-23(21,5)6/h8,10-11,13-15H,7,9,12,16-17H2,1-6H3/b11-8+,14-13+,18-10+,19-15+ |
| InChI Key | SFRPDSKECHTFQA-ONOWFSFQSA-N |
| Boiling Point | 453.7±14.0 °C |
| Flash Point | 128 °C |
| Purity | 95% |
| Density | 0.96 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.02 |
| Isomeric SMILES | CCC(=O)OC/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(CCCC1(C)C)C |
Retinyl Propionate, an ester of retinol and propionic acid, serves as a stable vitamin A derivative with enhanced skin penetration. This ingredient, upon enzymatic action within the skin, converts to retinol and subsequently to retinoic acid, providing the well-documented benefits of retinoids, such as activation of fibroblasts, increased collagen and hyaluronic acid production, inhibition of matrix metalloproteinases (MMPs), and skin thickening. Notably, it excels in boosting hyaluronic acid synthesis and impeding enzymes that degrade it, thereby surpassing other retinoids in this aspect. In skincare, Retinyl Propionate effectively diminishes wrinkles, enhances skin elasticity, and repairs sun damage, including actinic keratosis, thereby reversing signs of photoaging and promoting a more youthful appearance.
What is Retinyl Propionate, and how does it differ from other forms of vitamin A?
Retinyl Propionate is an ester of retinol and propionic acid, recognized as one of the stable forms of vitamin A. Unlike other vitamin A derivatives, such as retinyl palmitate (an ester of retinol and palmitic acid), Retinyl Propionate offers better penetration into the skin, allowing for higher concentrations to reach deeper layers. This ability to penetrate more effectively makes it a unique and valuable component in skincare formulations.
How does Retinyl Propionate work on the skin?
Retinyl Propionate is transformed by skin enzymes into retinol and then into active retinoic acid, which is known to provide the beneficial effects associated with retinoids. These benefits include the activation of fibroblasts, increased production of collagen and hyaluronic acid, and inhibition of matrix metalloproteinases (MMPs). Collectively, these actions contribute to skin thickening, improved elasticity, and the reduction of wrinkles.
What are the specific skincare benefits of using Retinyl Propionate?
The use of Retinyl Propionate in skincare helps to reduce wrinkles, improve skin elasticity, and heal sun damage, including conditions such as actinic keratosis, which result from chronic UV exposure. Furthermore, Retinyl Propionate acts as a more effective booster of hyaluronic acid production and inhibits the enzymes (MMPs) responsible for breaking it down, thereby supporting skin hydration and youthfulness.
Can Retinyl Propionate be stored in the skin, and if so, how?
Yes, excess Retinyl Propionate can be stored in the skin. When there is a surplus of retinol, it may be deposited in an esterified form, specifically as retinyl palmitate. This storage mechanism allows the skin to have a reserve of retinoid power that can be utilized over time.
How does Retinyl Propionate contribute to reversing photoaging?
Retinyl Propionate combats photoaging by lessening wrinkles, improving skin elasticity, and healing sun damage. By increasing collagen production and hyaluronic acid levels while inhibiting MMPs, it helps reverse UV-induced damage, exposing a more youthful and rejuvenated skin appearance.
If you have any questions, please contact us. You will get a satisfactory answer.
