Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1246 |
| Product Name | Retinyl Acetate |
| CAS | 127-47-9 |
| Structure |  |
| Synonyms | Retinol, acetate, all-trans-;Vitamin A acetate |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] acetate |
| Molecular Weight | 328.5 g/mol |
| Molecular Formula | C22H32O2 |
| InChI | InChI=1S/C22H32O2/c1-17(9-7-10-18(2)14-16-24-20(4)23)12-13-21-19(3)11-8-15-22(21,5)6/h7,9-10,12-14H,8,11,15-16H2,1-6H3/b10-7+,13-12+,17-9+,18-14+ |
| InChI Key | QGNJRVVDBSJHIZ-QHLGVNSISA-N |
| Boiling Point | 406 °C |
| Melting Point | 57-58 °C |
| Purity | 95% |
| Density | 1.05 g/mL |
| Appearance | Solid or viscous liquid |
| Highest Usage In Residency Products | 0.055 |
| Isomeric SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/COC(=O)C)/C)/C |
Retinyl Acetate is a key ingredient in both skin and oral care characterized by its stability as a vitamin A ester combined with acetic acid. At room temperature, it appears as an oily yellow liquid with a mild odor potentially containing crystals of vitamin A acetate. This compound undergoes decomposition through enzymatic activity in the skin or other tissues, converting it into an active form that enhances dermal cell proliferation and growth. Additionally, it stimulates cellular metabolism and enzyme activity, normalizing numerous skin processes and providing significant anti-aging benefits. This function is particularly beneficial for skin that has been photoaged or damaged by UV exposure. To mitigate the typical irritation associated with retinoids, Retinyl Acetate is often formulated with ingredients that encapsulate or moderate its effects. Complexes containing cyclodextrins liposomes and other carriers not only protect the ester from degradation but also facilitate controlled release, thereby reducing irritation and minimizing adverse effects.
What is Retinyl Acetate and how is it used in skincare?
Retinyl Acetate is a vitamin A ester combined with acetic acid. It is utilized as an active ingredient in skin and oral care products due to its stability and efficacy. Upon application, enzymes in the skin convert Retinyl Acetate into its active form, promoting dermal cell proliferation and supporting cellular metabolism.
What benefits does Retinyl Acetate provide for the skin?
Retinyl Acetate is known for its anti-aging properties, particularly effective in treating photoaged or UV-damaged skin. Its active form helps normalize various skin processes, enhances cellular metabolism, and stimulates enzyme activity, resulting in improved skin texture and diminished signs of aging.
How stable is Retinyl Acetate compared to other forms of vitamin A?
Retinyl Acetate is considered a stable form of vitamin A, which makes it an appealing choice for skincare formulations. It maintains its integrity more effectively than some other retinoids, offering a consistent performance in product applications.
Does Retinyl Acetate cause skin irritation?
While Retinyl Acetate is generally milder than some other retinoids, it can still cause irritation, especially to sensitive skin types. To mitigate this, it is often combined with encapsulating ingredients such as cyclodextrins or liposomes that provide controlled release and reduced irritation potential.
How is Retinyl Acetate protected in skincare formulations?
Retinyl Acetate is often incorporated into formulations with vitamin complexes and carrier molecules like liposomes and cyclodextrins. These carriers protect the vitamin A ester from decomposition in containers and allow for a controlled release into the skin, thereby minimizing adverse effects.
Is Retinyl Acetate suitable for all skin types?
Retinyl Acetate can be beneficial for many skin types, particularly those affected by aging or UV damage. However, individuals with sensitive skin should proceed with caution and ideally seek products specifically formulated to mitigate potential irritation. Consulting with a dermatologist can provide guidance tailored to individual skin needs.
If you have any questions, please contact us. You will get a satisfactory answer.
