Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-0541 |
| Product Name | Resveratrol |
| CAS | 501-36-0 |
| Structure |  |
| Synonyms | 3,4',5-Stilbenetriol |
| Description | Resveratrol is a natural phenol and a type of polyphenol that is found in various plant products, such as the skins of red grapes, blueberries, and peanuts. It is known for its antioxidant properties, and is believed to offer a number of potential health benefits. Some of these benefits may include the ability to reduce inflammation, prevent or treat certain types of cancer, improve heart health, and support brain health. |
| IUPAC Name | 5-[(E)-2-(4-Hydroxyphenyl)ethenyl]benzene-1,3-diol |
| Molecular Weight | 228.24 g/mol |
| Molecular Formula | C14H12O3 |
| Canonical SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |
| InChI | InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1+ |
| InChI Key | LUKBXSAWLPMMSZ-OWOJBTEDSA-N |
| Boiling Point | 449.1±14.0 °C |
| Melting Point | 253-255 °C |
| Flash Point | 222.3 °C |
| Purity | 98% |
| Density | 1.359±0.06 g/mL |
| Appearance | Off-white powder |
| Storage | -20 °C |
| Features And Benefits | 1. Antioxidant properties 2. Anti-inflammatory effects 3. UV protection 4. Anti-aging benefits 5. Skin brightening properties 6. Enhances wound healing 7. Improves skin texture and hydration |
| Isomeric SMILES | C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)O)O)O |
| Refractive Index | 1.762 |
| Size | 5g,25g |
| Topological Polar Surface Area | 60.7 Ų |
If you have any questions, please contact us. You will get a satisfactory answer.
