Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-0541 |
| Product Name | Resveratrol |
| CAS | 501-36-0 |
| Structure |  |
| Synonyms | 3,4',5-Stilbenetriol |
| Description | Resveratrol is a natural phenol and a type of polyphenol that is found in various plant products, such as the skins of red grapes, blueberries, and peanuts. It is known for its antioxidant properties, and is believed to offer a number of potential health benefits. Some of these benefits may include the ability to reduce inflammation, prevent or treat certain types of cancer, improve heart health, and support brain health. |
| IUPAC Name | 5-[(E)-2-(4-Hydroxyphenyl)ethenyl]benzene-1,3-diol |
| Molecular Weight | 228.24 g/mol |
| Molecular Formula | C14H12O3 |
| Canonical SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |
| InChI | InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1+ |
| InChI Key | LUKBXSAWLPMMSZ-OWOJBTEDSA-N |
| Boiling Point | 449.1±14.0 °C |
| Melting Point | 253-255 °C |
| Flash Point | 222.3 °C |
| Purity | 98% |
| Density | 1.359±0.06 g/mL |
| Appearance | Off-white powder |
| Storage | -20 °C |
| Features And Benefits | 1. Antioxidant properties 2. Anti-inflammatory effects 3. UV protection 4. Anti-aging benefits 5. Skin brightening properties 6. Enhances wound healing 7. Improves skin texture and hydration |
| Isomeric SMILES | C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)O)O)O |
| Refractive Index | 1.762 |
| Size | 5g,25g |
| Topological Polar Surface Area | 60.7 Ų |
Resveratrol, a prominent ingredient in anti-aging and skin-whitening products, is primarily derived from red grapes and is also present in berries, nuts, and cocoa powder. Its popularity surged in the 1990s after being suggested as a potential explanation for the French paradox, leading to extensive research worldwide. Scientifically acclaimed for its diverse benefits, resveratrol serves as a potent antioxidant, outperforming vitamins C and E in neutralizing free radicals, thereby preserving skin collagen and enhancing skin firmness and youthfulness. Additionally, its anti-inflammatory capabilities help delay skin aging by preventing collagen breakdown. Resveratrol also offers skin-whitening benefits by inhibiting melanin production, addressing hyperpigmentation, and promoting an even skin tone. Furthermore, it possesses antibacterial and antiviral properties, which may aid in combating various skin issues caused by germs. Resveratrol thus emerges as an ideal solution for achieving attractive, youthful, and smooth skin.
What is Resveratrol, and where can it be found?
Resveratrol is a prominent ingredient in anti-aging and skin-whitening beauty formulations. It is primarily found in red grapes, but berries, nuts, and cocoa powder are also considered good sources of this compound.
What are the benefits of Resveratrol for the skin?
Resveratrol offers a myriad of skin benefits. It acts as a powerful antioxidant, more effective than vitamins C and E, helping to neutralize free radicals and prevent the decrease in skin collagen. This results in firmer, more youthful-looking skin. It also possesses strong anti-inflammatory properties that retard skin aging by combating inflammation, which can lead to collagen degradation. Additionally, Resveratrol has a skin-whitening effect by restricting melanin production, leading to an even-toned skin finish.
How does Resveratrol contribute to skin whitening?
Resveratrol contributes to skin whitening by restricting the production of melanin, the pigment responsible for dark patches on the skin. This results in a more even-toned and brighter skin appearance.
Can Resveratrol fight skin-related infections?
Yes, Resveratrol displays antibacterial and antiviral properties, which can be beneficial in combating various germ-induced skin problems.
How does Resveratrol's antioxidant property benefit the skin?
As a robust antioxidant, Resveratrol is effective at neutralizing free radicals, which are known to damage skin cells and accelerate aging. By protecting the skin from these adversaries, it helps maintain skin collagen content, thereby fostering a youthful and firm appearance.
If you have any questions, please contact us. You will get a satisfactory answer.
