Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0105 |
| Product Name | Raffinose |
| CAS | 512-69-6 |
| Structure |  |
| Synonyms | β-D-Fructofuranosyl 6-O-α-D-galactopyranosyl-α-D-glucopyranoside |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[[(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Weight | 504.44 g/mol |
| Molecular Formula | C18H32O16 |
| InChI | InChI=1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+,13-,14-,15+,16+,17-,18+/m1/s1 |
| InChI Key | MUPFEKGTMRGPLJ-ZQSKZDJDSA-N |
| Boiling Point | 513.84 °C |
| Melting Point | 81 °C |
| Purity | 0.98 |
| Density | 1.81 g/mL |
| Appearance | White to off-white solid |
| Isomeric SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](O2)O[C@]3([C@H]([C@@H]([C@H](O3)CO)O)O)CO)O)O)O)O)O)O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
