Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0251 |
| Product Name | Quinine |
| CAS | 130-95-0 |
| Structure |  |
| Synonyms | (R)-[(2S,4S,5R)-1-Aza-5-vinylbicyclo[2.2.2]oct-2-yl](6-methoxyquinolin-4-yl)methanol0 |
| IUPAC Name | (R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| Molecular Weight | 324.4 g/mol |
| Molecular Formula | C20H24N2O2 |
| InChI | InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19-,20+/m0/s1 |
| InChI Key | LOUPRKONTZGTKE-WZBLMQSHSA-N |
| Boiling Point | 462.5 °C |
| Melting Point | 173-175 °C |
| Purity | 95% |
| Density | 1.13 g/mL |
| Appearance | Solid |
| Isomeric SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@H]([C@@H]3C[C@@H]4CCN3C[C@@H]4C=C)O |
| pKa | 8.52 |
If you have any questions, please contact us. You will get a satisfactory answer.
