Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0076 |
| Product Name | Quercetin |
| CAS | 117-39-5 |
| Structure |  |
| Synonyms | 3,3',4',5,7-Pentahydroxyflavone 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
| Molecular Weight | 302.23 g/mol |
| Molecular Formula | C15H10O7 |
| InChI | InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H |
| InChI Key | REFJWTPEDVJJIY-UHFFFAOYSA-N |
| Boiling Point | 363 °C |
| Melting Point | 316.5 °C |
| Purity | 95% |
| Density | 1.36 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.002 |
| Highest Usage In Rinsing Products | 0.002 |
| Isomeric SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |
| pKa | 6.31±0.40 |
If you have any questions, please contact us. You will get a satisfactory answer.
