Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1188 |
| Product Name | Propylene Glycol Isostearate |
| CAS | 68171-38-0 |
| Synonyms | 2-Hydroxypropyl 16-methylheptadecanoate |
| IUPAC Name | 2-hydroxypropyl 16-methylheptadecanoate |
| Molecular Weight | 342.56 g/mol |
| Molecular Formula | C21H42O3 |
| InChI | InChI=1S/C21H42O3/c1-19(2)16-14-12-10-8-6-4-5-7-9-11-13-15-17-21(23)24-18-20(3)22/h19-20,22H,4-18H2,1-3H3 |
| InChI Key | BJRXGOFKVBOFCO-UHFFFAOYSA-N |
| Purity | 0.98 |
| Density | 0.91 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.14 |
| Isomeric SMILES | CC(C)CCCCCCCCCCCCCCC(=O)OCC(C)O |
What is the chemical formula (MF) of PROPYLENE GLYCOL ISOSTEARATE?
The chemical formula of PROPYLENE GLYCOL ISOSTEARATE is C21H42O3.
What is the molecular weight (MW) of PROPYLENE GLYCOL ISOSTEARATE?
The molecular weight of PROPYLENE GLYCOL ISOSTEARATE is 342.55638.
What is the molecular structure of PROPYLENE GLYCOL ISOSTEARATE?
The molecular structure of PROPYLENE GLYCOL ISOSTEARATE can be found in the Mol File.
What is the chemical classification of PROPYLENE GLYCOL ISOSTEARATE?
PROPYLENE GLYCOL ISOSTEARATE is a type of ester compound.
Is PROPYLENE GLYCOL ISOSTEARATE a common ingredient in personal care products?
Yes, PROPYLENE GLYCOL ISOSTEARATE is a common ingredient in personal care products.
What are some potential uses of PROPYLENE GLYCOL ISOSTEARATE?
PROPYLENE GLYCOL ISOSTEARATE is often used as an emollient and emulsifier in various cosmetic and skincare products.
Why is the molecular weight of PROPYLENE GLYCOL ISOSTEARATE important to know?
The molecular weight of PROPYLENE GLYCOL ISOSTEARATE is important for calculating the proper dosage and mixing ratios in formulating products.
If you have any questions, please contact us. You will get a satisfactory answer.
