Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0203 |
| Product Name | Propyl Gallate |
| CAS | 121-79-9 |
| Structure |  |
| Synonyms | Benzoic acid, 3,4,5-trihydroxy-, propyl ester;Gallic acid, propyl ester;Propyl 3,4,5-trihydroxybenzoate |
| IUPAC Name | propyl 3,4,5-trihydroxybenzoate |
| Molecular Weight | 212.2 g/mol |
| Molecular Formula | C10H12O5 |
| InChI | InChI=1S/C10H12O5/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h4-5,11-13H,2-3H2,1H3 |
| InChI Key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| Boiling Point | 312 °C |
| Melting Point | 146-149 °C |
| Flash Point | 187°C |
| Purity | 95% |
| Density | 1.21 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.015 |
| Highest Usage In Rinsing Products | 0.0808 |
| Isomeric SMILES | CCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| pKa | 8.11 |
What is the chemical formula of propyl gallate?
The chemical formula of propyl gallate is C10H12O5.
What is the melting point of propyl gallate?
The melting point of propyl gallate is 146-149°C.
In what form does propyl gallate appear?
Propyl gallate appears as a fine white to creamy-white crystalline powder.
What is the main function of propyl gallate in foods?
Propyl gallate is used as an antioxidant in foods, especially in stabilizing animal fats and vegetable oils.
What is the primary safety concern associated with propyl gallate?
Propyl gallate is a skin sensitizing agent that can cause contact dermatitis in individuals exposed to it.
How is propyl gallate produced commercially?
Propyl gallate is commercially prepared by the esterification of gallic acid with propyl alcohol followed by distillation to remove excess alcohol.
What is the solubility of propyl gallate in ethanol?
Propyl gallate is soluble in ethanol at a concentration of 50 mg/mL.
What is the main application of propyl gallate in the cosmetics industry?
Propyl gallate is used as an antioxidant in cosmetics to prevent the oxidation of unsaturated fatty acids.
Can propyl gallate react with oxidizing agents?
Yes, propyl gallate can react with oxidizing agents.
Is propyl gallate considered safe for use in cosmetics and food products?
Yes, propyl gallate is generally recognized as safe (GRAS) for use as an antioxidant in cosmetics and food products.
If you have any questions, please contact us. You will get a satisfactory answer.
