Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1159 |
Product Name | Potassium PCA |
CAS | 4810-50-8 |
Structure | ![]() |
Synonyms | Potassium 5-oxo-L-prolinate |
IUPAC Name | potassium;(2S)-5-oxopyrrolidine-2-carboxylate |
Molecular Weight | 167.2 g/mol |
Molecular Formula | C5H6KNO3 |
InChI | InChI=1S/C5H7NO3.K/c7-4-2-1-3(6-4)5(8)9;/h3H,1-2H2,(H,6,7)(H,8,9);/q;+1/p-1/t3-;/m0./s1 |
InChI Key | WKHCFXKQKDNLEB-DFWYDOINSA-M |
Purity | 0.98 |
Appearance | Solid |
Highest Usage In Residency Products | 0.052 |
Isomeric SMILES | C1CC(=O)N[C@@H]1C(=O)[O-].[K+] |
What is the chemical name of potassium PCA?
The chemical name of potassium PCA is potassium 5-oxo-L-prolinate.
What are some synonyms of potassium 5-oxo-L-prolinate?
Some synonyms of potassium 5-oxo-L-prolinate are POTASSIUM PCA, 5-Oxo-L-proline potassium salt, and potassium,(2S)-5-oxopyrrolidine-2-carboxylate.
What is the molecular formula of potassium 5-oxo-L-prolinate?
The molecular formula of potassium 5-oxo-L-prolinate is C5H6KNO3.
What is the molecular weight of potassium 5-oxo-L-prolinate?
The molecular weight of potassium 5-oxo-L-prolinate is 167.20434.
What is the LogP value of potassium 5-oxo-L-prolinate?
The LogP value of potassium 5-oxo-L-prolinate is -2.387 (estimated).
What is the primary use of potassium PCA?
Potassium PCA is a humectant that improves skin moisturization.
How does potassium PCA improve skin moisturization?
Potassium PCA acts as a humectant by attracting and retaining moisture in the skin.
What is the function of potassium PCA in skincare products?
In skincare products, potassium PCA helps to hydrate and nourish the skin.
What is the EINECS number of potassium 5-oxo-L-prolinate?
The EINECS number of potassium 5-oxo-L-prolinate is 225-373-9.
Why is potassium PCA used in cosmetic products?
Potassium PCA is used in cosmetic products for its moisturizing and hydrating properties, which help improve the skin's overall appearance and health.