Our customer service representatives are available 24 hours a day, from Monday to Sunday.

Potassium Methoxysalicylate

Online Inquiry
Catalog Number CI-OT-0052
Product Name Potassium Methoxysalicylate
CAS 152312-71-5
Structure
Synonyms Potassium Methoxysalicylate
IUPAC Name potassium;2-hydroxy-4-methoxybenzoate
Molecular Weight 206 g/mol
Molecular Formula C8H7KO4
InChI InChI=1S/C8H8O4.K/c1-12-5-2-3-6(8(10)11)7(9)4-5;/h2-4,9H,1H3,(H,10,11);/q;+1/p-1
InChI Key YRJKYHIIYRGTCC-UHFFFAOYSA-M
Melting Point >220 °C
Purity 95%
Appearance Solid
Isomeric SMILES COC1=CC(=C(C=C1)C(=O)[O-])O.[K+]
Custom Q&A

What is the chemical name of the mentioned compound?

The chemical name of the compound is potassium 2-hydroxy-4-methoxybenzoate.

What are the synonyms of potassium 2-hydroxy-4-methoxybenzoate?

Some synonyms of potassium 2-hydroxy-4-methoxybenzoate are 4-MSAK, MSAK, P-Methoxy salicylic acid potassium salt, and POTASSIUM 4-METHOXYSALICYLATE.

What is the CAS number of potassium 2-hydroxy-4-methoxybenzoate?

The CAS number of potassium 2-hydroxy-4-methoxybenzoate is 152312-71-5.

What is the molecular formula of potassium 2-hydroxy-4-methoxybenzoate?

The molecular formula of potassium 2-hydroxy-4-methoxybenzoate is C8H7KO4.

What is the molecular weight of potassium 2-hydroxy-4-methoxybenzoate?

The molecular weight of potassium 2-hydroxy-4-methoxybenzoate is 206.24.

What is the melting point of potassium 2-hydroxy-4-methoxybenzoate?

The melting point of potassium 2-hydroxy-4-methoxybenzoate is >220°C (dec.).

In what type of atmosphere should potassium 2-hydroxy-4-methoxybenzoate be stored?

Potassium 2-hydroxy-4-methoxybenzoate should be stored in an inert atmosphere at room temperature.

What are the solubility properties of potassium 2-hydroxy-4-methoxybenzoate?

Potassium 2-hydroxy-4-methoxybenzoate is slightly soluble in DMSO, methanol, and water.

What is the form of potassium 2-hydroxy-4-methoxybenzoate?

Potassium 2-hydroxy-4-methoxybenzoate is in solid form.

How does potassium 2-hydroxy-4-methoxybenzoate work in skincare products?

Potassium 2-hydroxy-4-methoxybenzoate inhibits the activity of the enzyme tyrosinase, which is needed for melanin production, and can be used to lighten and balance skin tone, and reduce dark spots or age spots.

Online Inquiry
Verification code