Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0217 |
| Product Name | Potassium Benzoate |
| CAS | 582-25-2 |
| Structure |  |
| Synonyms | Benzoic acid, potassium salt |
| IUPAC Name | potassium;benzoate |
| Molecular Weight | 160.21 g/mol |
| Molecular Formula | C7H5KO2 |
| InChI | InChI=1S/C7H6O2.K/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/q;+1/p-1 |
| InChI Key | XAEFZNCEHLXOMS-UHFFFAOYSA-M |
| Boiling Point | 450 °C |
| Melting Point | >300 °C |
| Purity | 95% |
| Density | 1.56 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC=C(C=C1)C(=O)[O-].[K+] |
If you have any questions, please contact us. You will get a satisfactory answer.
