Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1262 |
| Product Name | Phloroglucinol Trimethyl Ether |
| CAS | 621-23-8 |
| Structure |  |
| Synonyms | Benzene, 1,3,5-trimethoxy-;1,3,5-Trimethoxybenzene |
| IUPAC Name | 1,3,5-trimethoxybenzene |
| Molecular Weight | 168.19 g/mol |
| Molecular Formula | C9H12O3 |
| InChI | InChI=1S/C9H12O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-6H,1-3H3 |
| InChI Key | LKUDPHPHKOZXCD-UHFFFAOYSA-N |
| Boiling Point | 255 °C |
| Melting Point | 50-53 °C |
| Purity | 95% |
| Density | 1.13 g/mL |
| Solubility | Insoluble |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0001 |
| Isomeric SMILES | COC1=CC(=CC(=C1)OC)OC |
If you have any questions, please contact us. You will get a satisfactory answer.
