Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0005 |
| Product Name | Phenethyl Acetate |
| CAS | 103-45-7 |
| Structure |  |
| Synonyms | Phenethyl acetate;Acetic acid, 2-phenylethyl ester;FEMA No. 2857 |
| IUPAC Name | 2-phenylethyl acetate |
| Molecular Weight | 164.2 g/mol |
| Molecular Formula | C10H12O2 |
| InChI | InChI=1S/C10H12O2/c1-9(11)12-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChI Key | MDHYEMXUFSJLGV-UHFFFAOYSA-N |
| Boiling Point | 238-239 °C |
| Melting Point | -31 °C |
| Purity | 95% |
| Density | 1.03 g/mL |
| Appearance | Liquid |
| Isomeric SMILES | CC(=O)OCCC1=CC=CC=C1 |
What is the chemical formula for Phenethyl acetate?
The chemical formula for Phenethyl acetate is C10H12O2.
What is the boiling point of Phenethyl acetate?
The boiling point of Phenethyl acetate is 238-239°C.
What is the odor type of Phenethyl acetate?
The odor type of Phenethyl acetate is floral.
In which products is Phenethyl acetate commonly used?
Phenethyl acetate is commonly used in cosmetic and soap essences, as well as in foods and alcoholic beverages.
What is the molecular weight of Phenethyl acetate?
The molecular weight of Phenethyl acetate is 164.2 g/mol.
What is the aroma threshold value for Phenethyl acetate?
The aroma threshold value for Phenethyl acetate is 3 to 5 ppm.
What is the taste threshold value for Phenethyl acetate at 50 ppm?
The taste characteristics at 50 ppm of Phenethyl acetate include fruity, sweet, honey, floral, tropical, rosy, with a slight yeasty, honey note with cocoa and balsamic nuances.
How is Phenethyl acetate synthesized?
Phenethyl acetate is synthesized by acetylation of phenylethyl alcohol.
What are some of the products where Phenethyl acetate is found naturally?
Phenethyl acetate is found naturally in apple, banana, grape, pineapple, tomato, cinnamon, peppermint oil, beer, whisky, tea, olive, and various other products.
What are some safety considerations for Phenethyl acetate?
Phenethyl acetate is moderately toxic by ingestion and mildly toxic by skin contact. It is a skin irritant and can react vigorously with oxidizing materials. When heated to decomposition, it emits acrid smoke and irritating fumes.
If you have any questions, please contact us. You will get a satisfactory answer.
