Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0077 |
| Product Name | Phenacetin |
| CAS | 62-44-2 |
| Structure |  |
| Synonyms | Acetamide, N-(4-ethoxyphenyl)- |
| IUPAC Name | N-(4-ethoxyphenyl)acetamide |
| Molecular Weight | 179.22 g/mol |
| Molecular Formula | C10H13NO2 |
| InChI | InChI=1S/C10H13NO2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h4-7H,3H2,1-2H3,(H,11,12) |
| InChI Key | CPJSUEIXXCENMM-UHFFFAOYSA-N |
| Boiling Point | 132 °C / 4mmHg |
| Melting Point | 133-136 °C |
| Purity | 95% |
| Density | 1.12 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CCOC1=CC=C(C=C1)NC(=O)C |
If you have any questions, please contact us. You will get a satisfactory answer.
