Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0083 |
| Product Name | Pentapeptide-31 |
| CAS | 1232137-75-5 |
| Synonyms | L-Serinamide, L-alanylglycyl-L-α-glutamyl-L-leucyl- |
| IUPAC Name | (4S)-5-[[(2S)-1-[[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-5-oxopentanoic acid |
| Molecular Weight | 474.52 g/mol |
| Molecular Formula | C19H34N6O8 |
| InChI | InChI=1S/C19H34N6O8/c1-9(2)6-12(19(33)25-13(8-26)16(21)30)24-18(32)11(4-5-15(28)29)23-14(27)7-22-17(31)10(3)20/h9-13,26H,4-8,20H2,1-3H3,(H2,21,30)(H,22,31)(H,23,27)(H,24,32)(H,25,33)(H,28,29)/t10-,11-,12-,13-/m0/s1 |
| InChI Key | SWVXQNMTYWWRJN-CYDGBPFRSA-N |
| Boiling Point | 998.6±65.0 °C |
| Purity | 0.95 |
| Density | 1.302 g/mL |
| Appearance | White powder |
| Storage | -15~-20 °C |
| Isomeric SMILES | C[C@@H](C(=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N)N |
| pKa | 4.43±0.10 |
| Safety | No heavy metals, no skin and eye irritation |
What is the chemical formula for Pentapeptide-31?
The chemical formula for Pentapeptide-31 is C19H34N6O8.
What is the molecular weight of Pentapeptide-31?
The molecular weight of Pentapeptide-31 is 474.52.
What are some synonyms for Pentapeptide-31?
Some synonyms for Pentapeptide-31 are L-Serinamide, L-alanylglycyl-L-α-glutamyl-L-leucyl-.
What is the CAS number for Pentapeptide-31?
The CAS number for Pentapeptide-31 is 1232137-75-5.
What is the predicted boiling point of Pentapeptide-31?
The predicted boiling point of Pentapeptide-31 is 998.6±65.0 °C.
What is the predicted density of Pentapeptide-31?
The predicted density of Pentapeptide-31 is 1.302±0.06 g/cm3.
What is the predicted pka value of Pentapeptide-31?
The predicted pka value of Pentapeptide-31 is 4.43±0.10.
What are the chemical properties of Pentapeptide-31?
The chemical properties of Pentapeptide-31 include its boiling point, density, and pka value.
How is Pentapeptide-31 represented in its molecular file?
Pentapeptide-31 is represented as 1232137-75-5.mol in its molecular file.
What are the potential uses or benefits of Pentapeptide-31?
The potential uses or benefits of Pentapeptide-31 may include skincare applications or anti-aging properties due to its peptide structure and composition.
If you have any questions, please contact us. You will get a satisfactory answer.
