Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1286 |
| Product Name | Pantothenic Acid |
| CAS | 79-83-4 |
| Structure |  |
| Synonyms | N-[(2R)-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl]-β-alanine |
| IUPAC Name | 3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoic acid |
| Molecular Weight | 219.23 g/mol |
| Molecular Formula | C9H17NO5 |
| InChI | InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/t7-/m0/s1 |
| InChI Key | GHOKWGTUZJEAQD-ZETCQYMHSA-N |
| Boiling Point | 360 °C |
| Melting Point | 178-179 °C |
| Purity | 95% |
| Density | 1.26 g/mL |
| Appearance | Oil to gel |
| Highest Usage In Residency Products | 0.05 |
| Isomeric SMILES | CC(C)(CO)[C@H](C(=O)NCCC(=O)O)O |
| pKa | 4.30±0.10 |
Pantothenic Acid, commonly recognized as Vitamin B5, plays a crucial role in both pharmaceutical and cosmetic applications. It swiftly transforms within cells to provide essential benefits, including acting as a potent wound-healing accelerator and effective moisturizer. This compound is instrumental in enhancing the skin's capacity to retain moisture while offering antibacterial and anti-inflammatory properties. Furthermore, Pantothenic Acid stimulates metabolic activities and enhances cellular health, making it a valuable ingredient in products designed to promote skin vitality and resilience.
What is Pantothenic Acid, and how does it relate to Panthenol?
Pantothenic Acid, also known as Vitamin B5, is an essential nutrient for the human body. Panthenol is the analog or provitamin of Pantothenic Acid, which means it is converted into Pantothenic Acid when it is applied to and absorbed by the skin. This conversion allows Panthenol to provide similar benefits as Vitamin B5.
How does Pantothenic Acid benefit the skin?
Pantothenic Acid is known for its moisturizing properties. It helps improve and increase the skin's ability to retain moisture, which can lead to a more hydrated and supple appearance. Additionally, it has antibacterial and anti-inflammatory effects, stimulates metabolic activities, and improves cell condition, making it a valuable ingredient in both pharmaceutical and cosmetic products.
In what types of products is Pantothenic Acid commonly used?
Pantothenic Acid is widely used in both pharmaceutical and cosmetic products. Its ability to act as a wound-healing accelerator and moisturizer makes it an attractive ingredient in a variety of skincare and medical formulations.
Can Pantothenic Acid help with wound healing?
Yes, Pantothenic Acid is used as a wound-healing accelerator. It assists in the repair process by improving the skin's hydration and facilitating cellular activities, which are crucial for effective healing.
Does Pantothenic Acid have any anti-inflammatory properties?
Pantothenic Acid indeed has anti-inflammatory properties. It can help reduce redness and swelling, making it beneficial for soothing irritated skin and conditions that involve inflammation.
If you have any questions, please contact us. You will get a satisfactory answer.
