Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1258 |
| Product Name | Pantolactone |
| CAS | 599-04-2 |
| Structure |  |
| Synonyms | Pantolactone;2(3H)-Furanone, dihydro-3-hydroxy-4,4-dimethyl-, (3R)- |
| IUPAC Name | (3R)-3-hydroxy-4,4-dimethyloxolan-2-one |
| Molecular Weight | 130.14 g/mol |
| Molecular Formula | C6H10O3 |
| InChI | InChI=1S/C6H10O3/c1-6(2)3-9-5(8)4(6)7/h4,7H,3H2,1-2H3/t4-/m0/s1 |
| InChI Key | SERHXTVXHNVDKA-BYPYZUCNSA-N |
| Boiling Point | 120-122 °C / 15mmHg |
| Melting Point | 91 °C |
| Purity | 95% |
| Density | 1.11 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.006 |
| Isomeric SMILES | CC1(COC(=O)[C@@H]1O)C |
If you have any questions, please contact us. You will get a satisfactory answer.
