Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0144 |
| Product Name | Palmitoyl tetrapeptide-3 |
| CAS | 1228558-05-1 |
| Synonyms | L-Lysine,L-prolyl-L-lysyl-L-α-glutamyl-,acetate(1:3) |
| IUPAC Name | 5-(3-ethylidene-2-methyl-1H-inden-2-yl)-1H-imidazole |
| Molecular Weight | 560.65 g/mol |
| Molecular Formula | C24H44N6O9 |
| InChI | InChI=1S/C15H16N2/c1-3-13-12-7-5-4-6-11(12)8-15(13,2)14-9-16-10-17-14/h3-7,9-10H,8H2,1-2H3,(H,16,17) |
| InChI Key | ZTGYIAGYEHXAFH-UHFFFAOYSA-N |
| Purity | 0.95 |
| Appearance | White powder |
| Storage | -15~-20 °C |
| Isomeric SMILES | CC=C1C2=CC=CC=C2CC1(C)C3=CN=CN3 |
| Safety | No heavy metals, no skin and eye irritation |
What is the chemical formula of PALMITOYL TETRAPEPTIDE-3?
The chemical formula of PALMITOYL TETRAPEPTIDE-3 is C24H44N6O9.
What are the synonyms of PALMITOYL TETRAPEPTIDE-3?
Some synonyms of PALMITOYL TETRAPEPTIDE-3 include Tetrapeptide-21/Tegopep, Tego pep, and Palmitoyl Tripeptide-1+Palmitoyl Tetrapeptide-7.
What is the CAS number of PALMITOYL TETRAPEPTIDE-3?
The CAS number of PALMITOYL TETRAPEPTIDE-3 is 1228558-05-1.
What is the role of PALMITOYL TETRAPEPTIDE-3 in cosmetics?
PALMITOYL TETRAPEPTIDE-3 helps to reduce the appearance of wrinkles and promote smoother, firmer skin in cosmetic products.
What are the chemical properties of PALMITOYL TETRAPEPTIDE-3?
The chemical properties of PALMITOYL TETRAPEPTIDE-3 include the sequence Palm-Gly-Gln-Pro-Arg-OH.
What is the molecular weight of PALMITOYL TETRAPEPTIDE-3?
The molecular weight of PALMITOYL TETRAPEPTIDE-3 is 560.65.
What is the primary usage of PALMITOYL TETRAPEPTIDE-3?
The primary usage of PALMITOYL TETRAPEPTIDE-3 is anti-wrikle (anti-wrinkle).
What are some cosmetic applications of PALMITOYL TETRAPEPTIDE-3?
PALMITOYL TETRAPEPTIDE-3 is commonly used in beauty products such as skincare and anti-aging creams.
If you have any questions, please contact us. You will get a satisfactory answer.
