Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-BP-0014 |
Product Name | Palmitoyl hexapeptide |
CAS | 171263-26-6 |
Structure | |
Synonyms | Palmitoyl hexapeptide-12, N-(1-Oxohexadecyl)-L-valylglycyl-L-valyl-L-alanyl-L-prolylglycine |
IUPAC Name | 2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-(hexadecanoylamino)-3-methylbutanoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]acetic acid |
Molecular Weight | 736.98 g/mol |
Molecular Formula | C38H68N6O8 |
InChI | InChI=1S/C38H68N6O8/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-22-30(45)42-33(26(2)3)36(50)39-24-31(46)43-34(27(4)5)37(51)41-28(6)38(52)44-23-20-21-29(44)35(49)40-25-32(47)48/h26-29,33-34H,7-25H2,1-6H3,(H,39,50)(H,40,49)(H,41,51)(H,42,45)(H,43,46)(H,47,48)/t28-,29-,33-,34-/m0/s1 |
InChI Key | JFSQSDAOQLNSQI-DTBJPNGVSA-N |
Boiling Point | 1024.8±65.0 °C |
Density | 1.105 g/mL |
Storage | Sealed in dry,Room Temperature |
Isomeric SMILES | CCCCCCCCCCCCCCCC(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)NCC(=O)O |
pKa | 3.67±0.10 |
What is the chemical formula of Palmitoyl Hexapeptide-12?
The chemical formula of Palmitoyl Hexapeptide-12 is C38H68N6O8.
What are some synonyms for Palmitoyl Hexapeptide-12?
Some synonyms for Palmitoyl Hexapeptide-12 include N-(1-Oxohexadecyl)-L-valylglycyl-L-valyl-L-alanyl-L-prolylglycine and Palmitoyl Hexapeptide.
What is the molecular weight of Palmitoyl Hexapeptide-12?
The molecular weight of Palmitoyl Hexapeptide-12 is 736.98 g/mol.
What is the recommended dosage of Palmitoyl Hexapeptide-12 for skin care?
The recommended dosage of Palmitoyl Hexapeptide-12 for skin care is 2~8%.
What are some benefits of Palmitoyl Hexapeptide-12?
Palmitoyl Hexapeptide-12 is known to boost elastin production, improve skin elasticity, and firmness.
What is the storage temperature recommended for Palmitoyl Hexapeptide-12?
Palmitoyl Hexapeptide-12 should be sealed in dry conditions at room temperature.
What is the predicted boiling point of Palmitoyl Hexapeptide-12?
The predicted boiling point of Palmitoyl Hexapeptide-12 is 1024.8°C.
What is the InChIKey for Palmitoyl Hexapeptide-12?
The InChIKey for Palmitoyl Hexapeptide-12 is JFSQSDAOQLNSQI-DTBJPNGVSA-N.
What is the structure of Palmitoyl Hexapeptide-12?
Palmitoyl Hexapeptide-12 has the sequence Pal-Val-Gly-Val-Ala-Pro-Gly-OH.
What is the category of products that Palmitoyl Hexapeptide-12 is commonly used in?
Palmitoyl Hexapeptide-12 is commonly used in cosmetics and beauty peptide products.