Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-BP-0074 |
Product Name | PAL-KT |
CAS | 911813-90-6 |
Structure | |
Synonyms | Palmitoyl dipeptide-7 |
IUPAC Name | (2S,3R)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxybutanoic acid |
Molecular Weight | 485.7 g/mol |
Molecular Formula | C26H51N3O5 |
InChI | InChI=1S/C26H51N3O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-23(31)28-22(18-16-17-20-27)25(32)29-24(21(2)30)26(33)34/h21-22,24,30H,3-20,27H2,1-2H3,(H,28,31)(H,29,32)(H,33,34)/t21-,22+,24+/m1/s1 |
InChI Key | FGSPQNZCLMWQAS-GPXNEJASSA-N |
Boiling Point | 722.8±60.0 °C |
Purity | 0.95 |
Density | 1.041 g/mL |
Appearance | White powder |
Storage | -15~-20 °C |
Isomeric SMILES | CCCCCCCCCCCCCCCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)O |
pKa | 3.25±0.10 |
Safety | No heavy metals, no skin and eye irritation |
What is the chemical formula for (2S,3R)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxybutanoic acid?
The chemical formula is C26H51N3O5.
What is the synonym for (2S,3R)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxybutanoic acid?
The synonym is Palmitoyl Dipeptide-7.
What is the boiling point of (2S,3R)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxybutanoic acid?
The boiling point is predicted to be 722.8±60.0 °C.
How is Palmitoyl Dipeptide-7 used in skincare?
Palmitoyl Dipeptide-7 accelerates the differentiation of the epidermis, promotes collagen synthesis, and increases the production of elastin, hyaluronic acid, glycosaminoglycans, and fiber connections for a more youthful appearance of the skin.
What is the mode of action of Palmitoyl Dipeptide-7?
It works by reducing the production of interleukin-6 (IL-6) which promotes inflammation in the skin, leading to slower degradation of collagen and younger-looking skin.
What is the color of (2S,3R)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxybutanoic acid?
It is white in color.
What is the molecular weight of (2S,3R)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxybutanoic acid?
The molecular weight is 485.7.
How does Palmitoyl Dipeptide-7 help with anti-aging?
It helps interrupt factors in the skin that lead to irritation and collagen loss, resulting in younger-looking skin.
What is the pka value of (2S,3R)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxybutanoic acid?
The pka value is predicted to be 3.25±0.10.
What is the primary function of Palmitoyl Dipeptide-7 in skincare products?
The primary function is to promote collagen synthesis, reduce inflammation, and improve the overall appearance of the skin.