Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0073 |
| Product Name | Paeonol |
| CAS | 552-41-0 |
| Structure |  |
| Synonyms | Ethanone, 1-(2-hydroxy-4-methoxyphenyl)- |
| IUPAC Name | 1-(2-hydroxy-4-methoxyphenyl)ethanone |
| Molecular Weight | 166.17 g/mol |
| Molecular Formula | C9H10O3 |
| InChI | InChI=1S/C9H10O3/c1-6(10)8-4-3-7(12-2)5-9(8)11/h3-5,11H,1-2H3 |
| InChI Key | UILPJVPSNHJFIK-UHFFFAOYSA-N |
| Boiling Point | 154 °C / 20mmHg |
| Melting Point | 48-50 °C |
| Purity | 95% |
| Density | 1.31 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.002 |
| Highest Usage In Rinsing Products | 0.003 |
| Isomeric SMILES | CC(=O)C1=C(C=C(C=C1)OC)O |
| pKa | 9.79±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
