Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0171 |
| Product Name | PABA |
| CAS | 150-13-0 |
| Structure |  |
| Synonyms | 4-Aminobenzoic acid;PABA |
| IUPAC Name | 4-aminobenzoic acid |
| Molecular Weight | 137.14 g/mol |
| Molecular Formula | C7H7NO2 |
| InChI | InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10) |
| InChI Key | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
| Boiling Point | 252 °C |
| Melting Point | 187-189 °C |
| Purity | 95% |
| Density | 1.37 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=CC=C1C(=O)O)N |
What is the chemical formula of PABA?
The chemical formula of PABA is H2NC6H4CO2H.
What are some synonyms for 4-Aminobenzoic acid?
Some synonyms for 4-Aminobenzoic acid include para-aminobenzoic acid (PABA), The aMino acid, and Folic acid Impurity.
What is the melting point of 4-Aminobenzoic acid?
The melting point of 4-Aminobenzoic acid is 187-189 °C (lit.).
What is the main use of 4-Aminobenzoic acid in sunscreens?
4-Aminobenzoic acid is used as an ingredient in sunscreens because it absorbs light throughout the UVB range.
How is 4-Aminobenzoic acid prepared?
4-Aminobenzoic acid is synthesized by reacting p-nitrobenzoic acid with sodium dodecyl sulfonate and Raney nickel under specific conditions.
What are the biological functions of 4-Aminbenzoic acid?
4-Aminobenzoic acid is important for the growth and division of body cells, can relieve anemia, and is used in combating fatigue and relieving stress.
What are some safety considerations for 4-Aminobenzoic acid?
It is moderately toxic by ingestion and intravenous routes and may cause nausea, vomiting, skin rash, methemoglobinemia, and toxic hepatitis.
What is the originator of 4-Aminobenzoic acid?
Pabalate is the originator of 4-Aminobenzoic acid.
How does 4-Aminobenzoic acid react with ferric salts?
4-Aminobenzoic acid is incompatible with ferric salts and oxidizing agents.
If you have any questions, please contact us. You will get a satisfactory answer.
