Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0284 |
| Product Name | p-Methylaminophenol |
| CAS | 150-75-4 |
| Structure |  |
| Synonyms | N-Methyl-4-hydroxyaniline |
| IUPAC Name | 4-(methylamino)phenol |
| Molecular Weight | 123.15 g/mol |
| Molecular Formula | C7H9NO |
| InChI | InChI=1S/C7H9NO/c1-8-6-2-4-7(9)5-3-6/h2-5,8-9H,1H3 |
| InChI Key | ZFIQGRISGKSVAG-UHFFFAOYSA-N |
| Boiling Point | 262.7±23.0 °C |
| Melting Point | 87 °C |
| Purity | 0.95 |
| Density | 1.15 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CNC1=CC=C(C=C1)O |
| pKa | 11.31±0.26 |
If you have any questions, please contact us. You will get a satisfactory answer.
