Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0028 |
| Product Name | Oxyquinoline Sulfate |
| CAS | 134-31-6 |
| Structure |  |
| Synonyms | 8-Quinolinol, sulfate (2:1) (salt);Bis(8-hydroxyquinolinium) sulphate |
| IUPAC Name | quinolin-8-ol;sulfuric acid |
| Molecular Weight | 388.4 g/mol |
| Molecular Formula | C18H16N2O6S |
| InChI | InChI=1S/2C9H7NO.H2O4S/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;1-5(2,3)4/h2*1-6,11H;(H2,1,2,3,4) |
| InChI Key | YYVFXSYQSOZCOQ-UHFFFAOYSA-N |
| Melting Point | 175 °C |
| Purity | 95% |
| Density | 1.38 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC2=C(C(=C1)O)N=CC=C2.C1=CC2=C(C(=C1)O)N=CC=C2.OS(=O)(=O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
