Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1314 |
| Product Name | Ornithine HCl |
| CAS | 3184-13-2 |
| Structure |  |
| Synonyms | Ornithine HCl;L-Ornithine, hydrochloride (1:1) |
| IUPAC Name | (2S)-2,5-diaminopentanoic acid;hydrochloride |
| Molecular Weight | 168.62 g/mol |
| Molecular Formula | C5H13ClN2O2 |
| InChI | InChI=1S/C5H12N2O2.ClH/c6-3-1-2-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);1H/t4-;/m0./s1 |
| InChI Key | GGTYBZJRPHEQDG-WCCKRBBISA-N |
| Melting Point | 245 °C |
| Purity | 95% |
| Density | 1.57 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0018 |
| Isomeric SMILES | C(C[C@@H](C(=O)O)N)CN.Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
