Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1270 |
| Product Name | Ornithine |
| CAS | 70-26-8 |
| Structure |  |
| Synonyms | Ornithine;Pentanoic acid, 2,5-diamino-, (S)- |
| IUPAC Name | (2S)-2,5-diaminopentanoic acid |
| Molecular Weight | 132.16 g/mol |
| Molecular Formula | C5H12N2O2 |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 |
| InChI Key | AHLPHDHHMVZTML-BYPYZUCNSA-N |
| Boiling Point | 244 °C |
| Melting Point | 140 °C |
| Purity | 95% |
| Density | 1.17 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.003 |
| Isomeric SMILES | C(C[C@@H](C(=O)O)N)CN |
If you have any questions, please contact us. You will get a satisfactory answer.
