Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1308 |
| Product Name | 2-O-Ethyl Ascorbic Acid |
| CAS | 112894-37-8 |
| Structure |  |
| Synonyms | L-Ascorbicacid,2-O-ethyl-(9CI) |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-ethoxy-3-hydroxy-2H-furan-5-one |
| Molecular Weight | 204.18 g/mol |
| Molecular Formula | C8H12O6 |
| InChI | InChI=1S/C8H12O6/c1-2-13-7-5(11)6(4(10)3-9)14-8(7)12/h4,6,9-11H,2-3H2,1H3/t4-,6+/m0/s1 |
| InChI Key | GXRFOOHMMLYYNW-UJURSFKZSA-N |
| Boiling Point | 506.0±50.0 °C |
| Purity | 0.97 |
| Density | 1.46 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.03 |
| Isomeric SMILES | CCOC1=C([C@H](OC1=O)[C@H](CO)O)O |
| pKa | 3.82±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
