Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0014 |
| Product Name | o-Cymen-5-ol |
| CAS | 3228-02-2 |
| Structure |  |
| Synonyms | Phenol, 3-methyl-4-(1-methylethyl)- |
| IUPAC Name | 3-methyl-4-propan-2-ylphenol |
| Molecular Weight | 150.22 g/mol |
| Molecular Formula | C10H14O |
| InChI | InChI=1S/C10H14O/c1-7(2)10-5-4-9(11)6-8(10)3/h4-7,11H,1-3H3 |
| InChI Key | IJALWSVNUBBQRA-UHFFFAOYSA-N |
| Boiling Point | 246 °C |
| Melting Point | 111-114 °C |
| Purity | 95% |
| Density | 0.969 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1=C(C=CC(=C1)O)C(C)C |
| pKa | 10.36±0.18 |
If you have any questions, please contact us. You will get a satisfactory answer.
