Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0192 |
| Product Name | Nordihydroguaiaretic Acid |
| CAS | 500-38-9 |
| Structure |  |
| Synonyms | 4,4'-(2,3-Dimethyl-1,4-butylene)dipyrocatechol |
| IUPAC Name | 4-[4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol |
| Molecular Weight | 302.4 g/mol |
| Molecular Formula | C18H22O4 |
| InChI | InChI=1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3 |
| InChI Key | HCZKYJDFEPMADG-UHFFFAOYSA-N |
| Boiling Point | 363.5 °C |
| Melting Point | 184-186 °C |
| Purity | 95% |
| Density | 1.08 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.03 |
| Isomeric SMILES | CC(CC1=CC(=C(C=C1)O)O)C(C)CC2=CC(=C(C=C2)O)O |
| pKa | 9.56±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
