Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0305 |
| Product Name | 4-Nitroguaiacol |
| CAS | 3251-56-7 |
| Structure |  |
| Synonyms | 2-Methoxy-4-nitrophenol |
| IUPAC Name | 2-methoxy-4-nitrophenol |
| Molecular Weight | 169.13 g/mol |
| Molecular Formula | C7H7NO4 |
| InChI | InChI=1S/C7H7NO4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h2-4,9H,1H3 |
| InChI Key | IZLVFLOBTPURLP-UHFFFAOYSA-N |
| Boiling Point | 298.5 °C |
| Melting Point | 102-104 °C |
| Purity | 95% |
| Density | 1.45 g/mL |
| Appearance | Solid |
| Isomeric SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])O |
| pKa | 7.05±0.22 |
If you have any questions, please contact us. You will get a satisfactory answer.
