Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0300 |
| Product Name | 2-Nitro-p-Phenylenediamine |
| CAS | 5307-14-2 |
| Structure |  |
| Synonyms | 1,4-Diamino-2-nitrobenzene |
| IUPAC Name | 2-nitrobenzene-1,4-diamine |
| Molecular Weight | 153.14 g/mol |
| Molecular Formula | C6H7N3O2 |
| InChI | InChI=1S/C6H7N3O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,7-8H2 |
| InChI Key | HVHNMNGARPCGGD-UHFFFAOYSA-N |
| Boiling Point | 276.04 °C |
| Melting Point | 135-138 °C |
| Purity | 0.95 |
| Density | 1.37 g/mL |
| Appearance | Powder |
| Isomeric SMILES | C1=CC(=C(C=C1N)[N+](=O)[O-])N |
If you have any questions, please contact us. You will get a satisfactory answer.
