Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0306 |
| Product Name | 3-Nitro-p-Hydroxyethylaminophenol |
| CAS | 65235-31-6 |
| Structure |  |
| Synonyms | 4-((2-Hydroxyethyl)amino)-3-nitrophenol |
| IUPAC Name | 4-(2-hydroxyethylamino)-3-nitrophenol |
| Molecular Weight | 198.18 g/mol |
| Molecular Formula | C8H10N2O4 |
| InChI | InChI=1S/C8H10N2O4/c11-4-3-9-7-2-1-6(12)5-8(7)10(13)14/h1-2,5,9,11-12H,3-4H2 |
| InChI Key | UXKLYBMQAHYULT-UHFFFAOYSA-N |
| Boiling Point | 446.3±45.0 °C |
| Melting Point | 142-146 °C |
| Purity | 95% |
| Density | 1.49 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])NCCO |
| pKa | 9.31±0.14 |
If you have any questions, please contact us. You will get a satisfactory answer.
