Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0276 |
| Product Name | 4-Nitro-o-phenylenediamine HCl |
| CAS | 53209-19-1 |
| Structure |  |
| Synonyms | 4-Nitrobenzene-1,2-diamine monohydrochloride |
| IUPAC Name | 4-nitrobenzene-1,2-diamine;hydrochloride |
| Molecular Weight | 189.6 g/mol |
| Molecular Formula | C6H8ClN3O2 |
| InChI | InChI=1S/C6H7N3O2.ClH/c7-5-2-1-4(9(10)11)3-6(5)8;/h1-3H,7-8H2;1H |
| InChI Key | IFTLGFVLGVXRBT-UHFFFAOYSA-N |
| Purity | 95% |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N)N.Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
