Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0287 |
| Product Name | 1-Naphthol |
| CAS | 90-15-3 |
| Structure |  |
| Synonyms | CI 76605 |
| IUPAC Name | naphthalen-1-ol |
| Molecular Weight | 144.17 g/mol |
| Molecular Formula | C10H8O |
| InChI | InChI=1S/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
| InChI Key | KJCVRFUGPWSIIH-UHFFFAOYSA-N |
| Boiling Point | 278-280 °C |
| Melting Point | 94-96 °C |
| Flash Point | 125 °C |
| Purity | 0.95 |
| Density | 1.22 g/mL |
| Appearance | White to Off-White Solid |
| Isomeric SMILES | C1=CC=C2C(=C1)C=CC=C2O |
| pKa | 9.34 |
If you have any questions, please contact us. You will get a satisfactory answer.
